C21H26N2O2S2 — CID 25395818
2-[4-(1,3-dithian-2-yl)phenoxy]-N-[2-(N-methylanilino)ethyl]acetamide (PubChem CID 25395818) has the molecular formula C21H26N2O2S2 and a molecular weight of 402.59 g/mol. Its IUPAC name is 2-[4-(1,3-dithian-2-yl)phenoxy]-N-[2-(N-methylanilino)ethyl]acetamide.
| Compound Name | 2-[4-(1,3-dithian-2-yl)phenoxy]-N-[2-(N-methylanilino)ethyl]acetamide |
|---|---|
| PubChem CID | 25395818 |
| Molecular Formula | C21H26N2O2S2 |
| Molecular Weight | 402.59 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | 2-[4-(1,3-dithian-2-yl)phenoxy]-N-[2-(N-methylanilino)ethyl]acetamide |
| SMILES | CN(CCNC(=O)COc1ccc(C2SCCCS2)cc1)c1ccccc1 |
| InChI | InChI=1S/C21H26N2O2S2/c1-23(18-6-3-2-4-7-18)13-12-22-20(24)16-25-19-10-8-17(9-11-19)21-26-14-5-15-27-21/h2-4,6-11,21H,5,12-16H2,1H3,(H,22,24) |
| InChIKey | YGMYHFOKIQJIML-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.59 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |