C18H20N2O2S2 — CID 51218811
2-[4-(1,3-dithian-2-yl)phenoxy]-N-(pyridin-2-ylmethyl)acetamide (PubChem CID 51218811) has the molecular formula C18H20N2O2S2 and a molecular weight of 360.50 g/mol. Its IUPAC name is 2-[4-(1,3-dithian-2-yl)phenoxy]-N-(pyridin-2-ylmethyl)acetamide.
| Compound Name | 2-[4-(1,3-dithian-2-yl)phenoxy]-N-(pyridin-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 51218811 |
| Molecular Formula | C18H20N2O2S2 |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | 2-[4-(1,3-dithian-2-yl)phenoxy]-N-(pyridin-2-ylmethyl)acetamide |
| SMILES | O=C(COc1ccc(C2SCCCS2)cc1)NCc1ccccn1 |
| InChI | InChI=1S/C18H20N2O2S2/c21-17(20-12-15-4-1-2-9-19-15)13-22-16-7-5-14(6-8-16)18-23-10-3-11-24-18/h1-2,4-9,18H,3,10-13H2,(H,20,21) |
| InChIKey | UFQJUWBUDFPKFL-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |