C15H19NO4S2 — CID 75429449
(2R)-2-[[2-[4-(1,3-dithian-2-yl)phenoxy]acetyl]amino]propanoic acid (PubChem CID 75429449) has the molecular formula C15H19NO4S2 and a molecular weight of 341.45 g/mol. Its IUPAC name is (2R)-2-[[2-[4-(1,3-dithian-2-yl)phenoxy]acetyl]amino]propanoic acid.
| Compound Name | (2R)-2-[[2-[4-(1,3-dithian-2-yl)phenoxy]acetyl]amino]propanoic acid |
|---|---|
| PubChem CID | 75429449 |
| Molecular Formula | C15H19NO4S2 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.08 |
| IUPAC Name | (2R)-2-[[2-[4-(1,3-dithian-2-yl)phenoxy]acetyl]amino]propanoic acid |
| SMILES | C[C@@H](NC(=O)COc1ccc(C2SCCCS2)cc1)C(=O)O |
| InChI | InChI=1S/C15H19NO4S2/c1-10(14(18)19)16-13(17)9-20-12-5-3-11(4-6-12)15-21-7-2-8-22-15/h3-6,10,15H,2,7-9H2,1H3,(H,16,17)(H,18,19)/t10-/m1/s1 |
| InChIKey | LBMXGEDDTHJPST-SNVBAGLBSA-N |
| XLogP | 2.52 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |