C18H25NO4S2 — CID 119361444
(2S)-2-[[2-[4-(1,3-dithian-2-yl)phenoxy]acetyl]amino]-4-methylpentanoic acid (PubChem CID 119361444) has the molecular formula C18H25NO4S2 and a molecular weight of 383.54 g/mol. Its IUPAC name is (2S)-2-[[2-[4-(1,3-dithian-2-yl)phenoxy]acetyl]amino]-4-methylpentanoic acid.
| Compound Name | (2S)-2-[[2-[4-(1,3-dithian-2-yl)phenoxy]acetyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 119361444 |
| Molecular Formula | C18H25NO4S2 |
| Molecular Weight | 383.54 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | (2S)-2-[[2-[4-(1,3-dithian-2-yl)phenoxy]acetyl]amino]-4-methylpentanoic acid |
| SMILES | CC(C)C[C@H](NC(=O)COc1ccc(C2SCCCS2)cc1)C(=O)O |
| InChI | InChI=1S/C18H25NO4S2/c1-12(2)10-15(17(21)22)19-16(20)11-23-14-6-4-13(5-7-14)18-24-8-3-9-25-18/h4-7,12,15,18H,3,8-11H2,1-2H3,(H,19,20)(H,21,22)/t15-/m0/s1 |
| InChIKey | SQJIDYBOLKPFBX-HNNXBMFYSA-N |
| XLogP | 3.55 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.54 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |