C20H22BrNO2S2 — CID 55383224
N-[1-(4-bromophenyl)ethyl]-2-[4-(1,3-dithian-2-yl)phenoxy]acetamide (PubChem CID 55383224) has the molecular formula C20H22BrNO2S2 and a molecular weight of 452.44 g/mol. Its IUPAC name is N-[1-(4-bromophenyl)ethyl]-2-[4-(1,3-dithian-2-yl)phenoxy]acetamide.
| Compound Name | N-[1-(4-bromophenyl)ethyl]-2-[4-(1,3-dithian-2-yl)phenoxy]acetamide |
|---|---|
| PubChem CID | 55383224 |
| Molecular Formula | C20H22BrNO2S2 |
| Molecular Weight | 452.44 g/mol |
| Exact Mass | 451.03 |
| IUPAC Name | N-[1-(4-bromophenyl)ethyl]-2-[4-(1,3-dithian-2-yl)phenoxy]acetamide |
| SMILES | CC(NC(=O)COc1ccc(C2SCCCS2)cc1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C20H22BrNO2S2/c1-14(15-3-7-17(21)8-4-15)22-19(23)13-24-18-9-5-16(6-10-18)20-25-11-2-12-26-20/h3-10,14,20H,2,11-13H2,1H3,(H,22,23) |
| InChIKey | URWRRDYSNTUHFQ-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.44 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |