C20H23NO2S2 — CID 86906475
4-(1,3-dithian-2-yl)-N-methyl-N-(2-phenoxyethyl)benzamide (PubChem CID 86906475) has the molecular formula C20H23NO2S2 and a molecular weight of 373.54 g/mol. Its IUPAC name is 4-(1,3-dithian-2-yl)-N-methyl-N-(2-phenoxyethyl)benzamide.
| Compound Name | 4-(1,3-dithian-2-yl)-N-methyl-N-(2-phenoxyethyl)benzamide |
|---|---|
| PubChem CID | 86906475 |
| Molecular Formula | C20H23NO2S2 |
| Molecular Weight | 373.54 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | 4-(1,3-dithian-2-yl)-N-methyl-N-(2-phenoxyethyl)benzamide |
| SMILES | CN(CCOc1ccccc1)C(=O)c1ccc(C2SCCCS2)cc1 |
| InChI | InChI=1S/C20H23NO2S2/c1-21(12-13-23-18-6-3-2-4-7-18)19(22)16-8-10-17(11-9-16)20-24-14-5-15-25-20/h2-4,6-11,20H,5,12-15H2,1H3 |
| InChIKey | OTXJGJPHAKVCBD-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.54 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |