C17H19NO3 — CID 28639806
N,N-dimethyl-4-(2-phenoxyethoxy)benzamide (PubChem CID 28639806) has the molecular formula C17H19NO3 and a molecular weight of 285.34 g/mol. Its IUPAC name is N,N-dimethyl-4-(2-phenoxyethoxy)benzamide.
| Compound Name | N,N-dimethyl-4-(2-phenoxyethoxy)benzamide |
|---|---|
| PubChem CID | 28639806 |
| Molecular Formula | C17H19NO3 |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.14 |
| IUPAC Name | N,N-dimethyl-4-(2-phenoxyethoxy)benzamide |
| SMILES | CN(C)C(=O)c1ccc(OCCOc2ccccc2)cc1 |
| InChI | InChI=1S/C17H19NO3/c1-18(2)17(19)14-8-10-16(11-9-14)21-13-12-20-15-6-4-3-5-7-15/h3-11H,12-13H2,1-2H3 |
| InChIKey | ZUQBROSOTNCAHF-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|