C22H34N2O2S2 — CID 55716486
2-[4-(1,3-dithian-2-yl)phenoxy]-N-[4-(4-methylpiperidin-1-yl)butyl]acetamide (PubChem CID 55716486) has the molecular formula C22H34N2O2S2 and a molecular weight of 422.66 g/mol. Its IUPAC name is 2-[4-(1,3-dithian-2-yl)phenoxy]-N-[4-(4-methylpiperidin-1-yl)butyl]acetamide.
| Compound Name | 2-[4-(1,3-dithian-2-yl)phenoxy]-N-[4-(4-methylpiperidin-1-yl)butyl]acetamide |
|---|---|
| PubChem CID | 55716486 |
| Molecular Formula | C22H34N2O2S2 |
| Molecular Weight | 422.66 g/mol |
| Exact Mass | 422.21 |
| IUPAC Name | 2-[4-(1,3-dithian-2-yl)phenoxy]-N-[4-(4-methylpiperidin-1-yl)butyl]acetamide |
| SMILES | CC1CCN(CCCCNC(=O)COc2ccc(C3SCCCS3)cc2)CC1 |
| InChI | InChI=1S/C22H34N2O2S2/c1-18-9-13-24(14-10-18)12-3-2-11-23-21(25)17-26-20-7-5-19(6-8-20)22-27-15-4-16-28-22/h5-8,18,22H,2-4,9-17H2,1H3,(H,23,25) |
| InChIKey | WDRJBMOKJQBKGX-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.66 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|