C18H20N2O3S2 — CID 71938593
2-[4-(1,3-dithian-2-yl)phenoxy]-N-(1-methyl-6-oxo-3-pyridinyl)acetamide (PubChem CID 71938593) has the molecular formula C18H20N2O3S2 and a molecular weight of 376.50 g/mol. Its IUPAC name is 2-[4-(1,3-dithian-2-yl)phenoxy]-N-(1-methyl-6-oxo-3-pyridinyl)acetamide.
| Compound Name | 2-[4-(1,3-dithian-2-yl)phenoxy]-N-(1-methyl-6-oxo-3-pyridinyl)acetamide |
|---|---|
| PubChem CID | 71938593 |
| Molecular Formula | C18H20N2O3S2 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | 2-[4-(1,3-dithian-2-yl)phenoxy]-N-(1-methyl-6-oxo-3-pyridinyl)acetamide |
| SMILES | Cn1cc(NC(=O)COc2ccc(C3SCCCS3)cc2)ccc1=O |
| InChI | InChI=1S/C18H20N2O3S2/c1-20-11-14(5-8-17(20)22)19-16(21)12-23-15-6-3-13(4-7-15)18-24-9-2-10-25-18/h3-8,11,18H,2,9-10,12H2,1H3,(H,19,21) |
| InChIKey | CODFPPZQRFVICW-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |