C18H20N2O4S3 — CID 34752593
2-[4-(1,3-dithian-2-yl)phenoxy]-N-(3-sulfamoylphenyl)acetamide (PubChem CID 34752593) has the molecular formula C18H20N2O4S3 and a molecular weight of 424.57 g/mol. Its IUPAC name is 2-[4-(1,3-dithian-2-yl)phenoxy]-N-(3-sulfamoylphenyl)acetamide.
| Compound Name | 2-[4-(1,3-dithian-2-yl)phenoxy]-N-(3-sulfamoylphenyl)acetamide |
|---|---|
| PubChem CID | 34752593 |
| Molecular Formula | C18H20N2O4S3 |
| Molecular Weight | 424.57 g/mol |
| Exact Mass | 424.06 |
| IUPAC Name | 2-[4-(1,3-dithian-2-yl)phenoxy]-N-(3-sulfamoylphenyl)acetamide |
| SMILES | NS(=O)(=O)c1cccc(NC(=O)COc2ccc(C3SCCCS3)cc2)c1 |
| InChI | InChI=1S/C18H20N2O4S3/c19-27(22,23)16-4-1-3-14(11-16)20-17(21)12-24-15-7-5-13(6-8-15)18-25-9-2-10-26-18/h1,3-8,11,18H,2,9-10,12H2,(H,20,21)(H2,19,22,23) |
| InChIKey | XDIOOTIBWIGDBS-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.57 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |