C17H16INO2S2 — CID 30274248
2-[4-(1,3-dithiolan-2-yl)phenoxy]-N-(3-iodophenyl)acetamide (PubChem CID 30274248) has the molecular formula C17H16INO2S2 and a molecular weight of 457.36 g/mol. Its IUPAC name is 2-[4-(1,3-dithiolan-2-yl)phenoxy]-N-(3-iodophenyl)acetamide.
| Compound Name | 2-[4-(1,3-dithiolan-2-yl)phenoxy]-N-(3-iodophenyl)acetamide |
|---|---|
| PubChem CID | 30274248 |
| Molecular Formula | C17H16INO2S2 |
| Molecular Weight | 457.36 g/mol |
| Exact Mass | 456.97 |
| IUPAC Name | 2-[4-(1,3-dithiolan-2-yl)phenoxy]-N-(3-iodophenyl)acetamide |
| SMILES | O=C(COc1ccc(C2SCCS2)cc1)Nc1cccc(I)c1 |
| InChI | InChI=1S/C17H16INO2S2/c18-13-2-1-3-14(10-13)19-16(20)11-21-15-6-4-12(5-7-15)17-22-8-9-23-17/h1-7,10,17H,8-9,11H2,(H,19,20) |
| InChIKey | WKEUAUQCQSZIQE-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.36 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|