C17H15FN2O4S2 — CID 9404960
2-[4-(1,3-dithiolan-2-yl)phenoxy]-N-(4-fluoro-3-nitrophenyl)acetamide (PubChem CID 9404960) has the molecular formula C17H15FN2O4S2 and a molecular weight of 394.45 g/mol. Its IUPAC name is 2-[4-(1,3-dithiolan-2-yl)phenoxy]-N-(4-fluoro-3-nitrophenyl)acetamide.
| Compound Name | 2-[4-(1,3-dithiolan-2-yl)phenoxy]-N-(4-fluoro-3-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 9404960 |
| Molecular Formula | C17H15FN2O4S2 |
| Molecular Weight | 394.45 g/mol |
| Exact Mass | 394.05 |
| IUPAC Name | 2-[4-(1,3-dithiolan-2-yl)phenoxy]-N-(4-fluoro-3-nitrophenyl)acetamide |
| SMILES | O=C(COc1ccc(C2SCCS2)cc1)Nc1ccc(F)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H15FN2O4S2/c18-14-6-3-12(9-15(14)20(22)23)19-16(21)10-24-13-4-1-11(2-5-13)17-25-7-8-26-17/h1-6,9,17H,7-8,10H2,(H,19,21) |
| InChIKey | CINIVZMDWVKGGV-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.45 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|