C21H23NO4S2 — CID 26285619
methyl 3-[[2-[4-(1,3-dithian-2-yl)phenoxy]acetyl]amino]-4-methylbenzoate (PubChem CID 26285619) has the molecular formula C21H23NO4S2 and a molecular weight of 417.55 g/mol. Its IUPAC name is methyl 3-[[2-[4-(1,3-dithian-2-yl)phenoxy]acetyl]amino]-4-methylbenzoate.
| Compound Name | methyl 3-[[2-[4-(1,3-dithian-2-yl)phenoxy]acetyl]amino]-4-methylbenzoate |
|---|---|
| PubChem CID | 26285619 |
| Molecular Formula | C21H23NO4S2 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.11 |
| IUPAC Name | methyl 3-[[2-[4-(1,3-dithian-2-yl)phenoxy]acetyl]amino]-4-methylbenzoate |
| SMILES | COC(=O)c1ccc(C)c(NC(=O)COc2ccc(C3SCCCS3)cc2)c1 |
| InChI | InChI=1S/C21H23NO4S2/c1-14-4-5-16(20(24)25-2)12-18(14)22-19(23)13-26-17-8-6-15(7-9-17)21-27-10-3-11-28-21/h4-9,12,21H,3,10-11,13H2,1-2H3,(H,22,23) |
| InChIKey | FJSMXCCUJGRADF-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |