C19H18F3NO2S2 — CID 122157598
4-(1,3-dithiolan-2-yl)-N-[2-[4-(trifluoromethyl)phenoxy]ethyl]benzamide (PubChem CID 122157598) has the molecular formula C19H18F3NO2S2 and a molecular weight of 413.49 g/mol. Its IUPAC name is 4-(1,3-dithiolan-2-yl)-N-[2-[4-(trifluoromethyl)phenoxy]ethyl]benzamide.
| Compound Name | 4-(1,3-dithiolan-2-yl)-N-[2-[4-(trifluoromethyl)phenoxy]ethyl]benzamide |
|---|---|
| PubChem CID | 122157598 |
| Molecular Formula | C19H18F3NO2S2 |
| Molecular Weight | 413.49 g/mol |
| Exact Mass | 413.07 |
| IUPAC Name | 4-(1,3-dithiolan-2-yl)-N-[2-[4-(trifluoromethyl)phenoxy]ethyl]benzamide |
| SMILES | O=C(NCCOc1ccc(C(F)(F)F)cc1)c1ccc(C2SCCS2)cc1 |
| InChI | InChI=1S/C19H18F3NO2S2/c20-19(21,22)15-5-7-16(8-6-15)25-10-9-23-17(24)13-1-3-14(4-2-13)18-26-11-12-27-18/h1-8,18H,9-12H2,(H,23,24) |
| InChIKey | VUNMLZAFIVQFIU-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.49 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|