C18H19NOS3 — CID 9482965
4-(1,3-dithiolan-2-yl)-N-(2-phenylsulfanylethyl)benzamide (PubChem CID 9482965) has the molecular formula C18H19NOS3 and a molecular weight of 361.56 g/mol. Its IUPAC name is 4-(1,3-dithiolan-2-yl)-N-(2-phenylsulfanylethyl)benzamide.
| Compound Name | 4-(1,3-dithiolan-2-yl)-N-(2-phenylsulfanylethyl)benzamide |
|---|---|
| PubChem CID | 9482965 |
| Molecular Formula | C18H19NOS3 |
| Molecular Weight | 361.56 g/mol |
| Exact Mass | 361.06 |
| IUPAC Name | 4-(1,3-dithiolan-2-yl)-N-(2-phenylsulfanylethyl)benzamide |
| SMILES | O=C(NCCSc1ccccc1)c1ccc(C2SCCS2)cc1 |
| InChI | InChI=1S/C18H19NOS3/c20-17(19-10-11-21-16-4-2-1-3-5-16)14-6-8-15(9-7-14)18-22-12-13-23-18/h1-9,18H,10-13H2,(H,19,20) |
| InChIKey | WJEFJWGBYOZZTR-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.56 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|