C20H23NOS2 — CID 26702921
4-(1,3-dithiolan-2-yl)-N-[(2R)-2-phenylbutyl]benzamide (PubChem CID 26702921) has the molecular formula C20H23NOS2 and a molecular weight of 357.54 g/mol. Its IUPAC name is 4-(1,3-dithiolan-2-yl)-N-[(2R)-2-phenylbutyl]benzamide.
| Compound Name | 4-(1,3-dithiolan-2-yl)-N-[(2R)-2-phenylbutyl]benzamide |
|---|---|
| PubChem CID | 26702921 |
| Molecular Formula | C20H23NOS2 |
| Molecular Weight | 357.54 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | 4-(1,3-dithiolan-2-yl)-N-[(2R)-2-phenylbutyl]benzamide |
| SMILES | CC[C@@H](CNC(=O)c1ccc(C2SCCS2)cc1)c1ccccc1 |
| InChI | InChI=1S/C20H23NOS2/c1-2-15(16-6-4-3-5-7-16)14-21-19(22)17-8-10-18(11-9-17)20-23-12-13-24-20/h3-11,15,20H,2,12-14H2,1H3,(H,21,22)/t15-/m0/s1 |
| InChIKey | JVZCHCPZACWNHS-HNNXBMFYSA-N |
| XLogP | 5.09 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.54 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |