C17H26N2OS2 — CID 86981262
N-[2-(diethylamino)propyl]-4-(1,3-dithiolan-2-yl)benzamide (PubChem CID 86981262) has the molecular formula C17H26N2OS2 and a molecular weight of 338.54 g/mol. Its IUPAC name is N-[2-(diethylamino)propyl]-4-(1,3-dithiolan-2-yl)benzamide.
| Compound Name | N-[2-(diethylamino)propyl]-4-(1,3-dithiolan-2-yl)benzamide |
|---|---|
| PubChem CID | 86981262 |
| Molecular Formula | C17H26N2OS2 |
| Molecular Weight | 338.54 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | N-[2-(diethylamino)propyl]-4-(1,3-dithiolan-2-yl)benzamide |
| SMILES | CCN(CC)C(C)CNC(=O)c1ccc(C2SCCS2)cc1 |
| InChI | InChI=1S/C17H26N2OS2/c1-4-19(5-2)13(3)12-18-16(20)14-6-8-15(9-7-14)17-21-10-11-22-17/h6-9,13,17H,4-5,10-12H2,1-3H3,(H,18,20) |
| InChIKey | UNRSMKWGRMDCFR-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.54 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |