C16H21NO3S2 — CID 8851137
[(2S)-1-oxo-1-(propylamino)propan-2-yl] 4-(1,3-dithiolan-2-yl)benzoate (PubChem CID 8851137) has the molecular formula C16H21NO3S2 and a molecular weight of 339.48 g/mol. Its IUPAC name is [(2S)-1-oxo-1-(propylamino)propan-2-yl] 4-(1,3-dithiolan-2-yl)benzoate.
| Compound Name | [(2S)-1-oxo-1-(propylamino)propan-2-yl] 4-(1,3-dithiolan-2-yl)benzoate |
|---|---|
| PubChem CID | 8851137 |
| Molecular Formula | C16H21NO3S2 |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.10 |
| IUPAC Name | [(2S)-1-oxo-1-(propylamino)propan-2-yl] 4-(1,3-dithiolan-2-yl)benzoate |
| SMILES | CCCNC(=O)[C@H](C)OC(=O)c1ccc(C2SCCS2)cc1 |
| InChI | InChI=1S/C16H21NO3S2/c1-3-8-17-14(18)11(2)20-15(19)12-4-6-13(7-5-12)16-21-9-10-22-16/h4-7,11,16H,3,8-10H2,1-2H3,(H,17,18)/t11-/m0/s1 |
| InChIKey | ZIVGDLKDPSIKJB-NSHDSACASA-N |
| XLogP | 3.24 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |