C14H17NO3S2 — CID 8595549
[(2R)-1-amino-1-oxopropan-2-yl] 4-(1,3-dithian-2-yl)benzoate (PubChem CID 8595549) has the molecular formula C14H17NO3S2 and a molecular weight of 311.43 g/mol. Its IUPAC name is [(2R)-1-amino-1-oxopropan-2-yl] 4-(1,3-dithian-2-yl)benzoate.
| Compound Name | [(2R)-1-amino-1-oxopropan-2-yl] 4-(1,3-dithian-2-yl)benzoate |
|---|---|
| PubChem CID | 8595549 |
| Molecular Formula | C14H17NO3S2 |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | [(2R)-1-amino-1-oxopropan-2-yl] 4-(1,3-dithian-2-yl)benzoate |
| SMILES | C[C@@H](OC(=O)c1ccc(C2SCCCS2)cc1)C(N)=O |
| InChI | InChI=1S/C14H17NO3S2/c1-9(12(15)16)18-13(17)10-3-5-11(6-4-10)14-19-7-2-8-20-14/h3-6,9,14H,2,7-8H2,1H3,(H2,15,16)/t9-/m1/s1 |
| InChIKey | WAHQRBWWWQZCFD-SECBINFHSA-N |
| XLogP | 2.59 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |