C19H24O5S2 — CID 139674445
diethyl 2-[4-(1,3-dithian-2-yl)benzoyl]butanedioate (PubChem CID 139674445) has the molecular formula C19H24O5S2 and a molecular weight of 396.53 g/mol. Its IUPAC name is diethyl 2-[4-(1,3-dithian-2-yl)benzoyl]butanedioate.
| Compound Name | diethyl 2-[4-(1,3-dithian-2-yl)benzoyl]butanedioate |
|---|---|
| PubChem CID | 139674445 |
| Molecular Formula | C19H24O5S2 |
| Molecular Weight | 396.53 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | diethyl 2-[4-(1,3-dithian-2-yl)benzoyl]butanedioate |
| SMILES | CCOC(=O)CC(C(=O)OCC)C(=O)c1ccc(C2SCCCS2)cc1 |
| InChI | InChI=1S/C19H24O5S2/c1-3-23-16(20)12-15(18(22)24-4-2)17(21)13-6-8-14(9-7-13)19-25-10-5-11-26-19/h6-9,15,19H,3-5,10-12H2,1-2H3 |
| InChIKey | GXYSQKIXUJEJFL-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.53 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|