C15H18O3S2 — CID 102093399
ethyl 2-(1,3-dithian-2-yl)-3-oxo-3-phenylpropanoate (PubChem CID 102093399) has the molecular formula C15H18O3S2 and a molecular weight of 310.44 g/mol. Its IUPAC name is ethyl 2-(1,3-dithian-2-yl)-3-oxo-3-phenylpropanoate.
| Compound Name | ethyl 2-(1,3-dithian-2-yl)-3-oxo-3-phenylpropanoate |
|---|---|
| PubChem CID | 102093399 |
| Molecular Formula | C15H18O3S2 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.07 |
| IUPAC Name | ethyl 2-(1,3-dithian-2-yl)-3-oxo-3-phenylpropanoate |
| SMILES | CCOC(=O)C(C(=O)c1ccccc1)C1SCCCS1 |
| InChI | InChI=1S/C15H18O3S2/c1-2-18-14(17)12(15-19-9-6-10-20-15)13(16)11-7-4-3-5-8-11/h3-5,7-8,12,15H,2,6,9-10H2,1H3 |
| InChIKey | NWYNAKPRRQQFPP-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|