C15H18O4 — CID 102477861
ethyl 2-(2,3,3,4,4,5,5-heptadeuteriooxolan-2-yl)-3-oxo-3-phenylpropanoate (PubChem CID 102477861) has the molecular formula C15H18O4 and a molecular weight of 269.35 g/mol. Its IUPAC name is ethyl 2-(2,3,3,4,4,5,5-heptadeuteriooxolan-2-yl)-3-oxo-3-phenylpropanoate.
| Compound Name | ethyl 2-(2,3,3,4,4,5,5-heptadeuteriooxolan-2-yl)-3-oxo-3-phenylpropanoate |
|---|---|
| PubChem CID | 102477861 |
| Molecular Formula | C15H18O4 |
| Molecular Weight | 269.35 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | ethyl 2-(2,3,3,4,4,5,5-heptadeuteriooxolan-2-yl)-3-oxo-3-phenylpropanoate |
| SMILES | [2H]C1([2H])OC([2H])(C(C(=O)OCC)C(=O)c2ccccc2)C([2H])([2H])C1([2H])[2H] |
| InChI | InChI=1S/C15H18O4/c1-2-18-15(17)13(12-9-6-10-19-12)14(16)11-7-4-3-5-8-11/h3-5,7-8,12-13H,2,6,9-10H2,1H3/i6D2,9D2,10D2,12D |
| InChIKey | FQPMINWDMIEMSM-JVGGKCONSA-N |
| XLogP | 2.23 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.35 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|