C16H20O3S2 — CID 40538521
ethyl (2R)-2-(1,3-dithiepan-2-yl)-3-oxo-3-phenylpropanoate (PubChem CID 40538521) has the molecular formula C16H20O3S2 and a molecular weight of 324.47 g/mol. Its IUPAC name is ethyl (2R)-2-(1,3-dithiepan-2-yl)-3-oxo-3-phenylpropanoate.
| Compound Name | ethyl (2R)-2-(1,3-dithiepan-2-yl)-3-oxo-3-phenylpropanoate |
|---|---|
| PubChem CID | 40538521 |
| Molecular Formula | C16H20O3S2 |
| Molecular Weight | 324.47 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | ethyl (2R)-2-(1,3-dithiepan-2-yl)-3-oxo-3-phenylpropanoate |
| SMILES | CCOC(=O)[C@@H](C(=O)c1ccccc1)C1SCCCCS1 |
| InChI | InChI=1S/C16H20O3S2/c1-2-19-15(18)13(16-20-10-6-7-11-21-16)14(17)12-8-4-3-5-9-12/h3-5,8-9,13,16H,2,6-7,10-11H2,1H3/t13-/m1/s1 |
| InChIKey | UAIAMYMZRKKLRB-CYBMUJFWSA-N |
| XLogP | 3.63 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.47 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|