C16H22N2O2S2 — CID 78773214
N-(1-amino-3-methyl-1-oxopentan-2-yl)-4-(1,3-dithiolan-2-yl)benzamide (PubChem CID 78773214) has the molecular formula C16H22N2O2S2 and a molecular weight of 338.50 g/mol. Its IUPAC name is N-(1-amino-3-methyl-1-oxopentan-2-yl)-4-(1,3-dithiolan-2-yl)benzamide.
| Compound Name | N-(1-amino-3-methyl-1-oxopentan-2-yl)-4-(1,3-dithiolan-2-yl)benzamide |
|---|---|
| PubChem CID | 78773214 |
| Molecular Formula | C16H22N2O2S2 |
| Molecular Weight | 338.50 g/mol |
| Exact Mass | 338.11 |
| IUPAC Name | N-(1-amino-3-methyl-1-oxopentan-2-yl)-4-(1,3-dithiolan-2-yl)benzamide |
| SMILES | CCC(C)C(NC(=O)c1ccc(C2SCCS2)cc1)C(N)=O |
| InChI | InChI=1S/C16H22N2O2S2/c1-3-10(2)13(14(17)19)18-15(20)11-4-6-12(7-5-11)16-21-8-9-22-16/h4-7,10,13,16H,3,8-9H2,1-2H3,(H2,17,19)(H,18,20) |
| InChIKey | SALAOKMAUBWEHU-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.50 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |