C17H21NOS2 — CID 36573754
N-(dicyclopropylmethyl)-4-(1,3-dithiolan-2-yl)benzamide (PubChem CID 36573754) has the molecular formula C17H21NOS2 and a molecular weight of 319.50 g/mol. Its IUPAC name is N-(dicyclopropylmethyl)-4-(1,3-dithiolan-2-yl)benzamide.
| Compound Name | N-(dicyclopropylmethyl)-4-(1,3-dithiolan-2-yl)benzamide |
|---|---|
| PubChem CID | 36573754 |
| Molecular Formula | C17H21NOS2 |
| Molecular Weight | 319.50 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | N-(dicyclopropylmethyl)-4-(1,3-dithiolan-2-yl)benzamide |
| SMILES | O=C(NC(C1CC1)C1CC1)c1ccc(C2SCCS2)cc1 |
| InChI | InChI=1S/C17H21NOS2/c19-16(18-15(11-1-2-11)12-3-4-12)13-5-7-14(8-6-13)17-20-9-10-21-17/h5-8,11-12,15,17H,1-4,9-10H2,(H,18,19) |
| InChIKey | FNSXWQNJHTXMNI-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.50 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |