C20H24N2OS2 — CID 8937300
N-[(1R)-2-(dimethylamino)-1-phenylethyl]-4-(1,3-dithiolan-2-yl)benzamide (PubChem CID 8937300) has the molecular formula C20H24N2OS2 and a molecular weight of 372.56 g/mol. Its IUPAC name is N-[(1R)-2-(dimethylamino)-1-phenylethyl]-4-(1,3-dithiolan-2-yl)benzamide.
| Compound Name | N-[(1R)-2-(dimethylamino)-1-phenylethyl]-4-(1,3-dithiolan-2-yl)benzamide |
|---|---|
| PubChem CID | 8937300 |
| Molecular Formula | C20H24N2OS2 |
| Molecular Weight | 372.56 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | N-[(1R)-2-(dimethylamino)-1-phenylethyl]-4-(1,3-dithiolan-2-yl)benzamide |
| SMILES | CN(C)C[C@H](NC(=O)c1ccc(C2SCCS2)cc1)c1ccccc1 |
| InChI | InChI=1S/C20H24N2OS2/c1-22(2)14-18(15-6-4-3-5-7-15)21-19(23)16-8-10-17(11-9-16)20-24-12-13-25-20/h3-11,18,20H,12-14H2,1-2H3,(H,21,23)/t18-/m0/s1 |
| InChIKey | WRONWZZQBRMHAI-SFHVURJKSA-N |
| XLogP | 4.20 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.56 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |