C16H21NO4S2 — CID 8851040
[(2S)-1-(2-methoxyethylamino)-1-oxopropan-2-yl] 4-(1,3-dithiolan-2-yl)benzoate (PubChem CID 8851040) has the molecular formula C16H21NO4S2 and a molecular weight of 355.48 g/mol. Its IUPAC name is [(2S)-1-(2-methoxyethylamino)-1-oxopropan-2-yl] 4-(1,3-dithiolan-2-yl)benzoate.
| Compound Name | [(2S)-1-(2-methoxyethylamino)-1-oxopropan-2-yl] 4-(1,3-dithiolan-2-yl)benzoate |
|---|---|
| PubChem CID | 8851040 |
| Molecular Formula | C16H21NO4S2 |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.09 |
| IUPAC Name | [(2S)-1-(2-methoxyethylamino)-1-oxopropan-2-yl] 4-(1,3-dithiolan-2-yl)benzoate |
| SMILES | COCCNC(=O)[C@H](C)OC(=O)c1ccc(C2SCCS2)cc1 |
| InChI | InChI=1S/C16H21NO4S2/c1-11(14(18)17-7-8-20-2)21-15(19)12-3-5-13(6-4-12)16-22-9-10-23-16/h3-6,11,16H,7-10H2,1-2H3,(H,17,18)/t11-/m0/s1 |
| InChIKey | HWQSUCOMVSXOPM-NSHDSACASA-N |
| XLogP | 2.47 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|