C18H19NOS — CID 9482902
N-(2-phenylsulfanylethyl)-2,3-dihydro-1H-indene-5-carboxamide (PubChem CID 9482902) has the molecular formula C18H19NOS and a molecular weight of 297.42 g/mol. Its IUPAC name is N-(2-phenylsulfanylethyl)-2,3-dihydro-1H-indene-5-carboxamide.
| Compound Name | N-(2-phenylsulfanylethyl)-2,3-dihydro-1H-indene-5-carboxamide |
|---|---|
| PubChem CID | 9482902 |
| Molecular Formula | C18H19NOS |
| Molecular Weight | 297.42 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | N-(2-phenylsulfanylethyl)-2,3-dihydro-1H-indene-5-carboxamide |
| SMILES | O=C(NCCSc1ccccc1)c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C18H19NOS/c20-18(16-10-9-14-5-4-6-15(14)13-16)19-11-12-21-17-7-2-1-3-8-17/h1-3,7-10,13H,4-6,11-12H2,(H,19,20) |
| InChIKey | QPGPJBXQHFRHFC-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.42 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|