3-(2,3-dihydro-1H-indene-5-carbonylamino)propanoic acid

C13H15NO3 — CID 18071901

IUPAC3-(2,3-dihydro-1H-indene-5-carbonylamino)propanoic acid
SMILESO=C(O)CCNC(=O)c1ccc2c(c1)CCC2
InChIInChI=1S/C13H15NO3/c15-12(16)6-7-14-13(17)11-5-4-9-2-1-3-10(9)8-11/h4-5,8H,1-3,6-7H2,(H,14,17)(H,15,16)
InChIKeyWOSDLYGBLSNJMX-UHFFFAOYSA-N
MW233.27 g/mol
LogP1.38
Rot. Bonds4

About 3-(2,3-dihydro-1H-indene-5-carbonylamino)propanoic acid

3-(2,3-dihydro-1H-indene-5-carbonylamino)propanoic acid (PubChem CID 18071901) has the molecular formula C13H15NO3 and a molecular weight of 233.27 g/mol. Its IUPAC name is 3-(2,3-dihydro-1H-indene-5-carbonylamino)propanoic acid.

Molecular Properties

Compound Name3-(2,3-dihydro-1H-indene-5-carbonylamino)propanoic acid
PubChem CID18071901
Molecular FormulaC13H15NO3
Molecular Weight233.27 g/mol
Exact Mass233.11
IUPAC Name3-(2,3-dihydro-1H-indene-5-carbonylamino)propanoic acid
SMILESO=C(O)CCNC(=O)c1ccc2c(c1)CCC2
InChIInChI=1S/C13H15NO3/c15-12(16)6-7-14-13(17)11-5-4-9-2-1-3-10(9)8-11/h4-5,8H,1-3,6-7H2,(H,14,17)(H,15,16)
InChIKeyWOSDLYGBLSNJMX-UHFFFAOYSA-N
XLogP1.38
TPSA66.40 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500233.27
LogP ≤ 51.38
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 3-(2,3-dihydro-1H-indene-5-carbonylamino)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(2,3-dihydro-1H-indene-5-carbonylamino)propanoic acid?
The IUPAC name of 3-(2,3-dihydro-1H-indene-5-carbonylamino)propanoic acid (CID 18071901) is 3-(2,3-dihydro-1H-indene-5-carbonylamino)propanoic acid.
What is the SMILES notation for 3-(2,3-dihydro-1H-indene-5-carbonylamino)propanoic acid?
The canonical SMILES for 3-(2,3-dihydro-1H-indene-5-carbonylamino)propanoic acid is O=C(O)CCNC(=O)c1ccc2c(c1)CCC2.
What is the InChIKey of 3-(2,3-dihydro-1H-indene-5-carbonylamino)propanoic acid?
The InChIKey is WOSDLYGBLSNJMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15NO3/c15-12(16)6-7-14-13(17)11-5-4-9-2-1-3-10(9)8-11/h4-5,8H,1-3,6-7H2,(H,14,17)(H,15,16).
What are the key properties of 3-(2,3-dihydro-1H-indene-5-carbonylamino)propanoic acid?
3-(2,3-dihydro-1H-indene-5-carbonylamino)propanoic acid has a molecular weight of 233.27 g/mol, XLogP of 1.38, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,3-dihydro-1H-indene-5-carbonylamino)propanoic acid is sourced from PubChem (CID 18071901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).