C20H21NO3S3 — CID 8953019
[2-oxo-2-(2-phenylsulfanylethylamino)ethyl] 4-(1,3-dithiolan-2-yl)benzoate (PubChem CID 8953019) has the molecular formula C20H21NO3S3 and a molecular weight of 419.59 g/mol. Its IUPAC name is [2-oxo-2-(2-phenylsulfanylethylamino)ethyl] 4-(1,3-dithiolan-2-yl)benzoate.
| Compound Name | [2-oxo-2-(2-phenylsulfanylethylamino)ethyl] 4-(1,3-dithiolan-2-yl)benzoate |
|---|---|
| PubChem CID | 8953019 |
| Molecular Formula | C20H21NO3S3 |
| Molecular Weight | 419.59 g/mol |
| Exact Mass | 419.07 |
| IUPAC Name | [2-oxo-2-(2-phenylsulfanylethylamino)ethyl] 4-(1,3-dithiolan-2-yl)benzoate |
| SMILES | O=C(COC(=O)c1ccc(C2SCCS2)cc1)NCCSc1ccccc1 |
| InChI | InChI=1S/C20H21NO3S3/c22-18(21-10-11-25-17-4-2-1-3-5-17)14-24-19(23)15-6-8-16(9-7-15)20-26-12-13-27-20/h1-9,20H,10-14H2,(H,21,22) |
| InChIKey | UZKSQVVXWTYSMM-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.59 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|