C19H19NO5S — CID 7604850
[2-oxo-2-(2-phenylsulfanylethylamino)ethyl] 2,3-dihydro-1,4-benzodioxine-6-carboxylate (PubChem CID 7604850) has the molecular formula C19H19NO5S and a molecular weight of 373.43 g/mol. Its IUPAC name is [2-oxo-2-(2-phenylsulfanylethylamino)ethyl] 2,3-dihydro-1,4-benzodioxine-6-carboxylate.
| Compound Name | [2-oxo-2-(2-phenylsulfanylethylamino)ethyl] 2,3-dihydro-1,4-benzodioxine-6-carboxylate |
|---|---|
| PubChem CID | 7604850 |
| Molecular Formula | C19H19NO5S |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.10 |
| IUPAC Name | [2-oxo-2-(2-phenylsulfanylethylamino)ethyl] 2,3-dihydro-1,4-benzodioxine-6-carboxylate |
| SMILES | O=C(COC(=O)c1ccc2c(c1)OCCO2)NCCSc1ccccc1 |
| InChI | InChI=1S/C19H19NO5S/c21-18(20-8-11-26-15-4-2-1-3-5-15)13-25-19(22)14-6-7-16-17(12-14)24-10-9-23-16/h1-7,12H,8-11,13H2,(H,20,21) |
| InChIKey | PKSUSXKLCKNIED-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|