About [2-oxo-2-(2-phenylsulfanylethylamino)ethyl] 2-benzylbenzoate
[2-oxo-2-(2-phenylsulfanylethylamino)ethyl] 2-benzylbenzoate (PubChem CID 7604677) has the molecular formula C24H23NO3S
and a molecular weight of 405.52 g/mol. Its IUPAC name is [2-oxo-2-(2-phenylsulfanylethylamino)ethyl] 2-benzylbenzoate.
Molecular Properties
| Compound Name | [2-oxo-2-(2-phenylsulfanylethylamino)ethyl] 2-benzylbenzoate |
| PubChem CID | 7604677 |
| Molecular Formula | C24H23NO3S |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | [2-oxo-2-(2-phenylsulfanylethylamino)ethyl] 2-benzylbenzoate |
| SMILES | O=C(COC(=O)c1ccccc1Cc1ccccc1)NCCSc1ccccc1 |
| InChI | InChI=1S/C24H23NO3S/c26-23(25-15-16-29-21-12-5-2-6-13-21)18-28-24(27)22-14-8-7-11-20(22)17-19-9-3-1-4-10-19/h1-14H,15-18H2,(H,25,26) |
| InChIKey | GGOKXSXUYPNIIT-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [2-oxo-2-(2-phenylsulfanylethylamino)ethyl] 2-benzylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-oxo-2-(2-phenylsulfanylethylamino)ethyl] 2-benzylbenzoate?
The IUPAC name of [2-oxo-2-(2-phenylsulfanylethylamino)ethyl] 2-benzylbenzoate (CID 7604677) is [2-oxo-2-(2-phenylsulfanylethylamino)ethyl] 2-benzylbenzoate.
What is the SMILES notation for [2-oxo-2-(2-phenylsulfanylethylamino)ethyl] 2-benzylbenzoate?
The canonical SMILES for [2-oxo-2-(2-phenylsulfanylethylamino)ethyl] 2-benzylbenzoate is O=C(COC(=O)c1ccccc1Cc1ccccc1)NCCSc1ccccc1.
What is the InChIKey of [2-oxo-2-(2-phenylsulfanylethylamino)ethyl] 2-benzylbenzoate?
The InChIKey is GGOKXSXUYPNIIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H23NO3S/c26-23(25-15-16-29-21-12-5-2-6-13-21)18-28-24(27)22-14-8-7-11-20(22)17-19-9-3-1-4-10-19/h1-14H,15-18H2,(H,25,26).
What are the key properties of [2-oxo-2-(2-phenylsulfanylethylamino)ethyl] 2-benzylbenzoate?
[2-oxo-2-(2-phenylsulfanylethylamino)ethyl] 2-benzylbenzoate has a molecular weight of 405.52 g/mol, XLogP of 4.34, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-oxo-2-(2-phenylsulfanylethylamino)ethyl] 2-benzylbenzoate is sourced from PubChem (CID 7604677), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).