C17H16ClNO4S — CID 8953509
[2-oxo-2-(2-phenylsulfanylethylamino)ethyl] 4-chloro-2-hydroxybenzoate (PubChem CID 8953509) has the molecular formula C17H16ClNO4S and a molecular weight of 365.84 g/mol. Its IUPAC name is [2-oxo-2-(2-phenylsulfanylethylamino)ethyl] 4-chloro-2-hydroxybenzoate.
| Compound Name | [2-oxo-2-(2-phenylsulfanylethylamino)ethyl] 4-chloro-2-hydroxybenzoate |
|---|---|
| PubChem CID | 8953509 |
| Molecular Formula | C17H16ClNO4S |
| Molecular Weight | 365.84 g/mol |
| Exact Mass | 365.05 |
| IUPAC Name | [2-oxo-2-(2-phenylsulfanylethylamino)ethyl] 4-chloro-2-hydroxybenzoate |
| SMILES | O=C(COC(=O)c1ccc(Cl)cc1O)NCCSc1ccccc1 |
| InChI | InChI=1S/C17H16ClNO4S/c18-12-6-7-14(15(20)10-12)17(22)23-11-16(21)19-8-9-24-13-4-2-1-3-5-13/h1-7,10,20H,8-9,11H2,(H,19,21) |
| InChIKey | UGNYEMVEDCZXFN-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.84 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|