C14H16ClNO6 — CID 9342399
[2-[(4-methoxy-4-oxobutyl)amino]-2-oxoethyl] 4-chloro-2-hydroxybenzoate (PubChem CID 9342399) has the molecular formula C14H16ClNO6 and a molecular weight of 329.74 g/mol. Its IUPAC name is [2-[(4-methoxy-4-oxobutyl)amino]-2-oxoethyl] 4-chloro-2-hydroxybenzoate.
| Compound Name | [2-[(4-methoxy-4-oxobutyl)amino]-2-oxoethyl] 4-chloro-2-hydroxybenzoate |
|---|---|
| PubChem CID | 9342399 |
| Molecular Formula | C14H16ClNO6 |
| Molecular Weight | 329.74 g/mol |
| Exact Mass | 329.07 |
| IUPAC Name | [2-[(4-methoxy-4-oxobutyl)amino]-2-oxoethyl] 4-chloro-2-hydroxybenzoate |
| SMILES | COC(=O)CCCNC(=O)COC(=O)c1ccc(Cl)cc1O |
| InChI | InChI=1S/C14H16ClNO6/c1-21-13(19)3-2-6-16-12(18)8-22-14(20)10-5-4-9(15)7-11(10)17/h4-5,7,17H,2-3,6,8H2,1H3,(H,16,18) |
| InChIKey | XSSJVVZPXWCDBG-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.74 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|