C12H10ClNO4 — CID 9342415
[2-oxo-2-(prop-2-ynylamino)ethyl] 4-chloro-2-hydroxybenzoate (PubChem CID 9342415) has the molecular formula C12H10ClNO4 and a molecular weight of 267.67 g/mol. Its IUPAC name is [2-oxo-2-(prop-2-ynylamino)ethyl] 4-chloro-2-hydroxybenzoate.
| Compound Name | [2-oxo-2-(prop-2-ynylamino)ethyl] 4-chloro-2-hydroxybenzoate |
|---|---|
| PubChem CID | 9342415 |
| Molecular Formula | C12H10ClNO4 |
| Molecular Weight | 267.67 g/mol |
| Exact Mass | 267.03 |
| IUPAC Name | [2-oxo-2-(prop-2-ynylamino)ethyl] 4-chloro-2-hydroxybenzoate |
| SMILES | C#CCNC(=O)COC(=O)c1ccc(Cl)cc1O |
| InChI | InChI=1S/C12H10ClNO4/c1-2-5-14-11(16)7-18-12(17)9-4-3-8(13)6-10(9)15/h1,3-4,6,15H,5,7H2,(H,14,16) |
| InChIKey | YTAXPBBLXDZYTA-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.67 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|