C14H15NO3 — CID 9229617
[2-oxo-2-(prop-2-ynylamino)ethyl] 2,4-dimethylbenzoate (PubChem CID 9229617) has the molecular formula C14H15NO3 and a molecular weight of 245.28 g/mol. Its IUPAC name is [2-oxo-2-(prop-2-ynylamino)ethyl] 2,4-dimethylbenzoate.
| Compound Name | [2-oxo-2-(prop-2-ynylamino)ethyl] 2,4-dimethylbenzoate |
|---|---|
| PubChem CID | 9229617 |
| Molecular Formula | C14H15NO3 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.11 |
| IUPAC Name | [2-oxo-2-(prop-2-ynylamino)ethyl] 2,4-dimethylbenzoate |
| SMILES | C#CCNC(=O)COC(=O)c1ccc(C)cc1C |
| InChI | InChI=1S/C14H15NO3/c1-4-7-15-13(16)9-18-14(17)12-6-5-10(2)8-11(12)3/h1,5-6,8H,7,9H2,2-3H3,(H,15,16) |
| InChIKey | SHOQMQVVKOABST-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|