C20H24N2O3 — CID 9229662
[2-[[4-(dimethylamino)phenyl]methylamino]-2-oxoethyl] 2,4-dimethylbenzoate (PubChem CID 9229662) has the molecular formula C20H24N2O3 and a molecular weight of 340.42 g/mol. Its IUPAC name is [2-[[4-(dimethylamino)phenyl]methylamino]-2-oxoethyl] 2,4-dimethylbenzoate.
| Compound Name | [2-[[4-(dimethylamino)phenyl]methylamino]-2-oxoethyl] 2,4-dimethylbenzoate |
|---|---|
| PubChem CID | 9229662 |
| Molecular Formula | C20H24N2O3 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | [2-[[4-(dimethylamino)phenyl]methylamino]-2-oxoethyl] 2,4-dimethylbenzoate |
| SMILES | Cc1ccc(C(=O)OCC(=O)NCc2ccc(N(C)C)cc2)c(C)c1 |
| InChI | InChI=1S/C20H24N2O3/c1-14-5-10-18(15(2)11-14)20(24)25-13-19(23)21-12-16-6-8-17(9-7-16)22(3)4/h5-11H,12-13H2,1-4H3,(H,21,23) |
| InChIKey | CPRRMFCCNGTBIY-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|