C19H22N2O4 — CID 2519513
[2-[(4-methoxyphenyl)methylamino]-2-oxoethyl] 4-(dimethylamino)benzoate (PubChem CID 2519513) has the molecular formula C19H22N2O4 and a molecular weight of 342.40 g/mol. Its IUPAC name is [2-[(4-methoxyphenyl)methylamino]-2-oxoethyl] 4-(dimethylamino)benzoate.
| Compound Name | [2-[(4-methoxyphenyl)methylamino]-2-oxoethyl] 4-(dimethylamino)benzoate |
|---|---|
| PubChem CID | 2519513 |
| Molecular Formula | C19H22N2O4 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | [2-[(4-methoxyphenyl)methylamino]-2-oxoethyl] 4-(dimethylamino)benzoate |
| SMILES | COc1ccc(CNC(=O)COC(=O)c2ccc(N(C)C)cc2)cc1 |
| InChI | InChI=1S/C19H22N2O4/c1-21(2)16-8-6-15(7-9-16)19(23)25-13-18(22)20-12-14-4-10-17(24-3)11-5-14/h4-11H,12-13H2,1-3H3,(H,20,22) |
| InChIKey | VEDWBMBBRFLOGW-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |