C20H22N2O5 — CID 9483689
[2-[[4-(dimethylamino)phenyl]methylamino]-2-oxoethyl] 2,3-dihydro-1,4-benzodioxine-6-carboxylate (PubChem CID 9483689) has the molecular formula C20H22N2O5 and a molecular weight of 370.41 g/mol. Its IUPAC name is [2-[[4-(dimethylamino)phenyl]methylamino]-2-oxoethyl] 2,3-dihydro-1,4-benzodioxine-6-carboxylate.
| Compound Name | [2-[[4-(dimethylamino)phenyl]methylamino]-2-oxoethyl] 2,3-dihydro-1,4-benzodioxine-6-carboxylate |
|---|---|
| PubChem CID | 9483689 |
| Molecular Formula | C20H22N2O5 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | [2-[[4-(dimethylamino)phenyl]methylamino]-2-oxoethyl] 2,3-dihydro-1,4-benzodioxine-6-carboxylate |
| SMILES | CN(C)c1ccc(CNC(=O)COC(=O)c2ccc3c(c2)OCCO3)cc1 |
| InChI | InChI=1S/C20H22N2O5/c1-22(2)16-6-3-14(4-7-16)12-21-19(23)13-27-20(24)15-5-8-17-18(11-15)26-10-9-25-17/h3-8,11H,9-10,12-13H2,1-2H3,(H,21,23) |
| InChIKey | RAVCSLQVBLNLKX-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|