C23H24O8 — CID 69065317
bis[(2,4-dimethylbenzoyl)oxymethyl] propanedioate (PubChem CID 69065317) has the molecular formula C23H24O8 and a molecular weight of 428.44 g/mol. Its IUPAC name is bis[(2,4-dimethylbenzoyl)oxymethyl] propanedioate.
| Compound Name | bis[(2,4-dimethylbenzoyl)oxymethyl] propanedioate |
|---|---|
| PubChem CID | 69065317 |
| Molecular Formula | C23H24O8 |
| Molecular Weight | 428.44 g/mol |
| Exact Mass | 428.15 |
| IUPAC Name | bis[(2,4-dimethylbenzoyl)oxymethyl] propanedioate |
| SMILES | Cc1ccc(C(=O)OCOC(=O)CC(=O)OCOC(=O)c2ccc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C23H24O8/c1-14-5-7-18(16(3)9-14)22(26)30-12-28-20(24)11-21(25)29-13-31-23(27)19-8-6-15(2)10-17(19)4/h5-10H,11-13H2,1-4H3 |
| InChIKey | XMYIMUSCZURAEI-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.44 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|