C19H20O5 — CID 2543120
[2-(3,4-dimethoxyphenyl)-2-oxoethyl] 2,4-dimethylbenzoate (PubChem CID 2543120) has the molecular formula C19H20O5 and a molecular weight of 328.36 g/mol. Its IUPAC name is [2-(3,4-dimethoxyphenyl)-2-oxoethyl] 2,4-dimethylbenzoate.
| Compound Name | [2-(3,4-dimethoxyphenyl)-2-oxoethyl] 2,4-dimethylbenzoate |
|---|---|
| PubChem CID | 2543120 |
| Molecular Formula | C19H20O5 |
| Molecular Weight | 328.36 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | [2-(3,4-dimethoxyphenyl)-2-oxoethyl] 2,4-dimethylbenzoate |
| SMILES | COc1ccc(C(=O)COC(=O)c2ccc(C)cc2C)cc1OC |
| InChI | InChI=1S/C19H20O5/c1-12-5-7-15(13(2)9-12)19(21)24-11-16(20)14-6-8-17(22-3)18(10-14)23-4/h5-10H,11H2,1-4H3 |
| InChIKey | UGFKUBKRAFMDIC-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.36 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |