C18H18O6 — CID 2510229
[2-(3,4-dimethoxyphenyl)-2-oxoethyl] 4-methoxybenzoate (PubChem CID 2510229) has the molecular formula C18H18O6 and a molecular weight of 330.34 g/mol. Its IUPAC name is [2-(3,4-dimethoxyphenyl)-2-oxoethyl] 4-methoxybenzoate.
| Compound Name | [2-(3,4-dimethoxyphenyl)-2-oxoethyl] 4-methoxybenzoate |
|---|---|
| PubChem CID | 2510229 |
| Molecular Formula | C18H18O6 |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.11 |
| IUPAC Name | [2-(3,4-dimethoxyphenyl)-2-oxoethyl] 4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)OCC(=O)c2ccc(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C18H18O6/c1-21-14-7-4-12(5-8-14)18(20)24-11-15(19)13-6-9-16(22-2)17(10-13)23-3/h4-10H,11H2,1-3H3 |
| InChIKey | SJDPKJLZDPDOAN-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |