C18H16F2O6 — CID 2612428
[2-(3,4-dimethoxyphenyl)-2-oxoethyl] 4-(difluoromethoxy)benzoate (PubChem CID 2612428) has the molecular formula C18H16F2O6 and a molecular weight of 366.32 g/mol. Its IUPAC name is [2-(3,4-dimethoxyphenyl)-2-oxoethyl] 4-(difluoromethoxy)benzoate.
| Compound Name | [2-(3,4-dimethoxyphenyl)-2-oxoethyl] 4-(difluoromethoxy)benzoate |
|---|---|
| PubChem CID | 2612428 |
| Molecular Formula | C18H16F2O6 |
| Molecular Weight | 366.32 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | [2-(3,4-dimethoxyphenyl)-2-oxoethyl] 4-(difluoromethoxy)benzoate |
| SMILES | COc1ccc(C(=O)COC(=O)c2ccc(OC(F)F)cc2)cc1OC |
| InChI | InChI=1S/C18H16F2O6/c1-23-15-8-5-12(9-16(15)24-2)14(21)10-25-17(22)11-3-6-13(7-4-11)26-18(19)20/h3-9,18H,10H2,1-2H3 |
| InChIKey | HBPMQWBRKLRVMP-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.32 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |