C17H15FO5 — CID 2511319
[2-(3,4-dimethoxyphenyl)-2-oxoethyl] 2-fluorobenzoate (PubChem CID 2511319) has the molecular formula C17H15FO5 and a molecular weight of 318.30 g/mol. Its IUPAC name is [2-(3,4-dimethoxyphenyl)-2-oxoethyl] 2-fluorobenzoate.
| Compound Name | [2-(3,4-dimethoxyphenyl)-2-oxoethyl] 2-fluorobenzoate |
|---|---|
| PubChem CID | 2511319 |
| Molecular Formula | C17H15FO5 |
| Molecular Weight | 318.30 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | [2-(3,4-dimethoxyphenyl)-2-oxoethyl] 2-fluorobenzoate |
| SMILES | COc1ccc(C(=O)COC(=O)c2ccccc2F)cc1OC |
| InChI | InChI=1S/C17H15FO5/c1-21-15-8-7-11(9-16(15)22-2)14(19)10-23-17(20)12-5-3-4-6-13(12)18/h3-9H,10H2,1-2H3 |
| InChIKey | IWILUMOICBXVPC-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.30 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |