C18H16F2O7S — CID 9467947
[2-[4-(difluoromethoxy)-3-methoxyphenyl]-2-oxoethyl] 4-methylsulfonylbenzoate (PubChem CID 9467947) has the molecular formula C18H16F2O7S and a molecular weight of 414.38 g/mol. Its IUPAC name is [2-[4-(difluoromethoxy)-3-methoxyphenyl]-2-oxoethyl] 4-methylsulfonylbenzoate.
| Compound Name | [2-[4-(difluoromethoxy)-3-methoxyphenyl]-2-oxoethyl] 4-methylsulfonylbenzoate |
|---|---|
| PubChem CID | 9467947 |
| Molecular Formula | C18H16F2O7S |
| Molecular Weight | 414.38 g/mol |
| Exact Mass | 414.06 |
| IUPAC Name | [2-[4-(difluoromethoxy)-3-methoxyphenyl]-2-oxoethyl] 4-methylsulfonylbenzoate |
| SMILES | COc1cc(C(=O)COC(=O)c2ccc(S(C)(=O)=O)cc2)ccc1OC(F)F |
| InChI | InChI=1S/C18H16F2O7S/c1-25-16-9-12(5-8-15(16)27-18(19)20)14(21)10-26-17(22)11-3-6-13(7-4-11)28(2,23)24/h3-9,18H,10H2,1-2H3 |
| InChIKey | KHZBZWJCORHVNE-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.38 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |