C17H18Cl2N2O4 — CID 8848035
[2-oxo-2-(prop-2-ynylamino)ethyl] (2S)-2-[(2,4-dichlorobenzoyl)amino]-3-methylbutanoate (PubChem CID 8848035) has the molecular formula C17H18Cl2N2O4 and a molecular weight of 385.25 g/mol. Its IUPAC name is [2-oxo-2-(prop-2-ynylamino)ethyl] (2S)-2-[(2,4-dichlorobenzoyl)amino]-3-methylbutanoate.
| Compound Name | [2-oxo-2-(prop-2-ynylamino)ethyl] (2S)-2-[(2,4-dichlorobenzoyl)amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 8848035 |
| Molecular Formula | C17H18Cl2N2O4 |
| Molecular Weight | 385.25 g/mol |
| Exact Mass | 384.06 |
| IUPAC Name | [2-oxo-2-(prop-2-ynylamino)ethyl] (2S)-2-[(2,4-dichlorobenzoyl)amino]-3-methylbutanoate |
| SMILES | C#CCNC(=O)COC(=O)[C@@H](NC(=O)c1ccc(Cl)cc1Cl)C(C)C |
| InChI | InChI=1S/C17H18Cl2N2O4/c1-4-7-20-14(22)9-25-17(24)15(10(2)3)21-16(23)12-6-5-11(18)8-13(12)19/h1,5-6,8,10,15H,7,9H2,2-3H3,(H,20,22)(H,21,23)/t15-/m0/s1 |
| InChIKey | HWIBYQYZIKHNAU-HNNXBMFYSA-N |
| XLogP | 2.04 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.25 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|