C16H19ClN2O5S — CID 8848989
[2-oxo-2-(prop-2-ynylamino)ethyl] (2S)-2-[(3-chlorophenyl)sulfonylamino]-3-methylbutanoate (PubChem CID 8848989) has the molecular formula C16H19ClN2O5S and a molecular weight of 386.86 g/mol. Its IUPAC name is [2-oxo-2-(prop-2-ynylamino)ethyl] (2S)-2-[(3-chlorophenyl)sulfonylamino]-3-methylbutanoate.
| Compound Name | [2-oxo-2-(prop-2-ynylamino)ethyl] (2S)-2-[(3-chlorophenyl)sulfonylamino]-3-methylbutanoate |
|---|---|
| PubChem CID | 8848989 |
| Molecular Formula | C16H19ClN2O5S |
| Molecular Weight | 386.86 g/mol |
| Exact Mass | 386.07 |
| IUPAC Name | [2-oxo-2-(prop-2-ynylamino)ethyl] (2S)-2-[(3-chlorophenyl)sulfonylamino]-3-methylbutanoate |
| SMILES | C#CCNC(=O)COC(=O)[C@@H](NS(=O)(=O)c1cccc(Cl)c1)C(C)C |
| InChI | InChI=1S/C16H19ClN2O5S/c1-4-8-18-14(20)10-24-16(21)15(11(2)3)19-25(22,23)13-7-5-6-12(17)9-13/h1,5-7,9,11,15,19H,8,10H2,2-3H3,(H,18,20)/t15-/m0/s1 |
| InChIKey | GQGIFAGVSMXTHK-HNNXBMFYSA-N |
| XLogP | 0.94 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.86 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|