C14H15ClN2O5S — CID 8841962
[2-oxo-2-(prop-2-ynylamino)ethyl] (2S)-2-[(4-chlorophenyl)sulfonylamino]propanoate (PubChem CID 8841962) has the molecular formula C14H15ClN2O5S and a molecular weight of 358.80 g/mol. Its IUPAC name is [2-oxo-2-(prop-2-ynylamino)ethyl] (2S)-2-[(4-chlorophenyl)sulfonylamino]propanoate.
| Compound Name | [2-oxo-2-(prop-2-ynylamino)ethyl] (2S)-2-[(4-chlorophenyl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 8841962 |
| Molecular Formula | C14H15ClN2O5S |
| Molecular Weight | 358.80 g/mol |
| Exact Mass | 358.04 |
| IUPAC Name | [2-oxo-2-(prop-2-ynylamino)ethyl] (2S)-2-[(4-chlorophenyl)sulfonylamino]propanoate |
| SMILES | C#CCNC(=O)COC(=O)[C@H](C)NS(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H15ClN2O5S/c1-3-8-16-13(18)9-22-14(19)10(2)17-23(20,21)12-6-4-11(15)5-7-12/h1,4-7,10,17H,8-9H2,2H3,(H,16,18)/t10-/m0/s1 |
| InChIKey | PAWAJYALTAMDRM-JTQLQIEISA-N |
| XLogP | 0.30 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.80 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|