C18H20ClNO4S — CID 7573393
benzyl (2S)-2-[(3-chlorophenyl)sulfonylamino]-3-methylbutanoate (PubChem CID 7573393) has the molecular formula C18H20ClNO4S and a molecular weight of 381.88 g/mol. Its IUPAC name is benzyl (2S)-2-[(3-chlorophenyl)sulfonylamino]-3-methylbutanoate.
| Compound Name | benzyl (2S)-2-[(3-chlorophenyl)sulfonylamino]-3-methylbutanoate |
|---|---|
| PubChem CID | 7573393 |
| Molecular Formula | C18H20ClNO4S |
| Molecular Weight | 381.88 g/mol |
| Exact Mass | 381.08 |
| IUPAC Name | benzyl (2S)-2-[(3-chlorophenyl)sulfonylamino]-3-methylbutanoate |
| SMILES | CC(C)[C@H](NS(=O)(=O)c1cccc(Cl)c1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C18H20ClNO4S/c1-13(2)17(18(21)24-12-14-7-4-3-5-8-14)20-25(22,23)16-10-6-9-15(19)11-16/h3-11,13,17,20H,12H2,1-2H3/t17-/m0/s1 |
| InChIKey | OWBUVSBRRXAVKH-KRWDZBQOSA-N |
| XLogP | 3.39 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.88 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |