C16H18ClN3O5S — CID 26003755
3-chloro-N-[(2R)-1-[2-(furan-2-carbonyl)hydrazinyl]-3-methyl-1-oxobutan-2-yl]benzenesulfonamide (PubChem CID 26003755) has the molecular formula C16H18ClN3O5S and a molecular weight of 399.86 g/mol. Its IUPAC name is 3-chloro-N-[(2R)-1-[2-(furan-2-carbonyl)hydrazinyl]-3-methyl-1-oxobutan-2-yl]benzenesulfonamide.
| Compound Name | 3-chloro-N-[(2R)-1-[2-(furan-2-carbonyl)hydrazinyl]-3-methyl-1-oxobutan-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 26003755 |
| Molecular Formula | C16H18ClN3O5S |
| Molecular Weight | 399.86 g/mol |
| Exact Mass | 399.07 |
| IUPAC Name | 3-chloro-N-[(2R)-1-[2-(furan-2-carbonyl)hydrazinyl]-3-methyl-1-oxobutan-2-yl]benzenesulfonamide |
| SMILES | CC(C)[C@@H](NS(=O)(=O)c1cccc(Cl)c1)C(=O)NNC(=O)c1ccco1 |
| InChI | InChI=1S/C16H18ClN3O5S/c1-10(2)14(16(22)19-18-15(21)13-7-4-8-25-13)20-26(23,24)12-6-3-5-11(17)9-12/h3-10,14,20H,1-2H3,(H,18,21)(H,19,22)/t14-/m1/s1 |
| InChIKey | OUXWBCFAQJCSIN-CQSZACIVSA-N |
| XLogP | 1.70 |
| TPSA | 117.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.86 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|